Yazar Ol - Yazar Girişi
NND Sözlük

Ana Sayfa > trigliserit nedir, trigliserit ne demek (trigliserit nnd)

trigliserit nedir, trigliserit ne demek?

Onlinebilet.com Banner


  1. Genel formülü CH2(OOCR1)CH(OOR2)CH2(OOR3) olan, hayvan, bitki ve deniz ürünlerinin özütlenmesinden elde edilen, yenilebilir yağların ve monogliseritlerin imalatında kullanılan, yağ asitleri ve gliserolden doğal olarak meydana gelen bir ester.
  2. Triaçilgliserol.
  3. Triaçilgliserol.
  4. (en) Triglyceride.
  5. (fr) Triglyceride

genel (nedir ne demek)

  1. Bir şeye veya bir kimseye özgü olmayıp onun bütün benzerlerini içine alan, umumi.
  2. Ayrıntıları göz önüne alınmayarak bütünü bakımından ele alınan
    Örnek: Genel bir sıralama yapmak gerekirse, denebilir ki, dünyada en iyisi mutlu, dengeli bir evliliktir. H. Taner
  3. Yetkisi ve sorumluluğu çok olan.
  4. Herkesin yararlanabileceği (yer, nesne).
  5. Bir genelleme sonucunda elde edilen.
  6. Cinsle, türle ilgili olan; bir türün, bir cinsin bütün nesnelerini içinde toplayan; bir nesne sınıfının bütün nesnelerini toplayan.
  7. Azlık, çokluk ya da bütünlüğü belirlemeden bir sınıfta birçok bireylere (ya da her biri bölünmez bir bütün kuran bir çok öbeklere) uygun düşen.
  8. Bir sınıfın bireylerinin büyük bir bölümüne uygun düşen. "Genellikle", "genel olarak" deyimleri günlük dilde de bu anlamda kullanılır. Genellikle dendiğinde kuraldışına yer var demektir. Bu anlamda genel hem tümele hem kuraldışına karşıttır.
  9. Bk. evrensel
  10. (en) Exoteric.
  11. (en) Generic.
  12. (en) Grand.
  13. (en) Liberal.
  14. (en) Overhead.
  15. (en) Plenary.
  16. (en) Public.
  17. (en) Broad.
  18. (en) Common.
  19. (en) Collective.
  20. (en) Across-the-board.
  21. (en) Blanket.
  22. (en) Catholic.
  23. (en) Abstract.
  24. (en) Current.
  25. (en) Popular.
  26. (en) Rife.
  27. (en) Universal.
  28. (en) Global.
  29. (en) Broad / adj.
  30. (en) Overall.
  31. (en) General.
  32. (en) Prevailing.
  33. (en) Prevalent.
  34. (en) Running.
  35. (en) Sweeping.
  36. (en) Widespread.
  37. (en) Pandemic.
  38. (fr) Général
  39. (la) Generalis

formül (nedir ne demek)

  1. Genel bir olguyu, bir kuralı veya ilkeyi açıklayan simgeler takımı.
  2. Bir belgenin yazılacağı biçimi ve ona özgü olan deyimi gösteren örnek
    Örnek: Cevap formülü son derece basit idi. F. R. Atay
  3. Kalıplaşmış, basmakalıp anlatım.
  4. Bir veya birçok niceliğe bağlı bulunan bir niceliğin hesaplanmasına yarayan matematiksel anlatım.
  5. Çıkar yol, tutulan yol, yöntem
    Örnek: Her yerde yapılabilen bir şey, yalnız formülleri, şekilleri değişir. A. Gündüz
  6. Birleşik bir cismin birleşimine giren maddeleri ve bunların o birleşik maddedeki oranlarını gösteren kısaltma takımı.
  7. Bir bileşiği oluşturan öğelerin nitelik ve niceliksel bakımdan durumunu gösteren, simge ve sayılardan oluşmuş yazma biçimi.
  8. (en) Formulary.
  9. (en) Prescription.
  10. (en) Recipe.
  11. (en) Printed form.
  12. (en) Equation.
  13. (en) Formula.


Bunları Kaçırmayın

  • BİS, bir sözün içinde geçtiği başka sözler bulmak için üretilmiş bir araçtır, özellikle birden çok sözden oluşan çeşitli terim ve deyimleri bulmaya yarar. (BİS Kelime Türetmece)
  • Belirli harflerini bildiğiniz kelimeleri bulabilirsiniz. (Bulmaca Yardımcısı)
  • Başka dil araçlarına bakın. (Türkçe Dil Araçları)

Hakkında  -  Araçlar  -  Testler  -  Son Eklenenler  -  Yasal Konular  -  Yardım  -  İletişim

© Nedir Ne Demek (NND Sözlük)
Türkçe-Türkçe, Türkçe-İngilizce, İngilizce-Türkçe, İngilizce-İngilizce Nedir Ne Demek (NND Sözlük)